C13H17IN2O3 — CID 103929880
2-[[(2R)-2-amino-3,3-dimethylbutanoyl]amino]-5-iodobenzoic acid (PubChem CID 103929880) has the molecular formula C13H17IN2O3 and a molecular weight of 376.19 g/mol. Its IUPAC name is 2-[[(2R)-2-amino-3,3-dimethylbutanoyl]amino]-5-iodobenzoic acid.
| Compound Name | 2-[[(2R)-2-amino-3,3-dimethylbutanoyl]amino]-5-iodobenzoic acid |
|---|---|
| PubChem CID | 103929880 |
| Molecular Formula | C13H17IN2O3 |
| Molecular Weight | 376.19 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | 2-[[(2R)-2-amino-3,3-dimethylbutanoyl]amino]-5-iodobenzoic acid |
| SMILES | CC(C)(C)[C@@H](N)C(=O)Nc1ccc(I)cc1C(=O)O |
| InChI | InChI=1S/C13H17IN2O3/c1-13(2,3)10(15)11(17)16-9-5-4-7(14)6-8(9)12(18)19/h4-6,10H,15H2,1-3H3,(H,16,17)(H,18,19)/t10-/m0/s1 |
| InChIKey | YUBKENLYPVBQJA-JTQLQIEISA-N |
| XLogP | 2.30 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.19 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|