C9H5F6NO2 — CID 39871456
2,2,2-trifluoroethyl N-(2,3,4-trifluorophenyl)carbamate (PubChem CID 39871456) has the molecular formula C9H5F6NO2 and a molecular weight of 273.13 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-(2,3,4-trifluorophenyl)carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-(2,3,4-trifluorophenyl)carbamate |
|---|---|
| PubChem CID | 39871456 |
| Molecular Formula | C9H5F6NO2 |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 2,2,2-trifluoroethyl N-(2,3,4-trifluorophenyl)carbamate |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)OCC(F)(F)F |
| InChI | InChI=1S/C9H5F6NO2/c10-4-1-2-5(7(12)6(4)11)16-8(17)18-3-9(13,14)15/h1-2H,3H2,(H,16,17) |
| InChIKey | IRELMEOWQOTGBB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|