C12H9ClF3N3O2 — CID 65173978
2,2,2-trifluoroethyl N-(5-chloro-2-pyrazol-1-ylphenyl)carbamate (PubChem CID 65173978) has the molecular formula C12H9ClF3N3O2 and a molecular weight of 319.67 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-(5-chloro-2-pyrazol-1-ylphenyl)carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-(5-chloro-2-pyrazol-1-ylphenyl)carbamate |
|---|---|
| PubChem CID | 65173978 |
| Molecular Formula | C12H9ClF3N3O2 |
| Molecular Weight | 319.67 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | 2,2,2-trifluoroethyl N-(5-chloro-2-pyrazol-1-ylphenyl)carbamate |
| SMILES | O=C(Nc1cc(Cl)ccc1-n1cccn1)OCC(F)(F)F |
| InChI | InChI=1S/C12H9ClF3N3O2/c13-8-2-3-10(19-5-1-4-17-19)9(6-8)18-11(20)21-7-12(14,15)16/h1-6H,7H2,(H,18,20) |
| InChIKey | BYJXPKWQGIKXJX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.67 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |