C12H10F3N3O2 — CID 47089503
2,2,2-trifluoroethyl N-(3-pyrazol-1-ylphenyl)carbamate (PubChem CID 47089503) has the molecular formula C12H10F3N3O2 and a molecular weight of 285.23 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-(3-pyrazol-1-ylphenyl)carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-(3-pyrazol-1-ylphenyl)carbamate |
|---|---|
| PubChem CID | 47089503 |
| Molecular Formula | C12H10F3N3O2 |
| Molecular Weight | 285.23 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 2,2,2-trifluoroethyl N-(3-pyrazol-1-ylphenyl)carbamate |
| SMILES | O=C(Nc1cccc(-n2cccn2)c1)OCC(F)(F)F |
| InChI | InChI=1S/C12H10F3N3O2/c13-12(14,15)8-20-11(19)17-9-3-1-4-10(7-9)18-6-2-5-16-18/h1-7H,8H2,(H,17,19) |
| InChIKey | YFFOJVWOHDHYTM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.23 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |