C12H10Cl3N3O2 — CID 86245202
2,2,2-trichloroethyl N-(4-pyrazol-1-ylphenyl)carbamate (PubChem CID 86245202) has the molecular formula C12H10Cl3N3O2 and a molecular weight of 334.59 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-(4-pyrazol-1-ylphenyl)carbamate.
| Compound Name | 2,2,2-trichloroethyl N-(4-pyrazol-1-ylphenyl)carbamate |
|---|---|
| PubChem CID | 86245202 |
| Molecular Formula | C12H10Cl3N3O2 |
| Molecular Weight | 334.59 g/mol |
| Exact Mass | 332.98 |
| IUPAC Name | 2,2,2-trichloroethyl N-(4-pyrazol-1-ylphenyl)carbamate |
| SMILES | O=C(Nc1ccc(-n2cccn2)cc1)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H10Cl3N3O2/c13-12(14,15)8-20-11(19)17-9-2-4-10(5-3-9)18-7-1-6-16-18/h1-7H,8H2,(H,17,19) |
| InChIKey | JZKHAMAJVJXMBQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.59 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|