C10H7F6NO2 — CID 39871511
2,2,2-trifluoroethyl N-[3-(trifluoromethyl)phenyl]carbamate (PubChem CID 39871511) has the molecular formula C10H7F6NO2 and a molecular weight of 287.16 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-[3-(trifluoromethyl)phenyl]carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-[3-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 39871511 |
| Molecular Formula | C10H7F6NO2 |
| Molecular Weight | 287.16 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 2,2,2-trifluoroethyl N-[3-(trifluoromethyl)phenyl]carbamate |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)OCC(F)(F)F |
| InChI | InChI=1S/C10H7F6NO2/c11-9(12,13)5-19-8(18)17-7-3-1-2-6(4-7)10(14,15)16/h1-4H,5H2,(H,17,18) |
| InChIKey | GPEOZDBOTBZPFU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.16 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |