C10H7F3LiNO3 — CID 23693664
lithium 3-oxo-3-[3-(trifluoromethyl)anilino]propanoate (PubChem CID 23693664) has the molecular formula C10H7F3LiNO3 and a molecular weight of 253.10 g/mol. Its IUPAC name is lithium 3-oxo-3-[3-(trifluoromethyl)anilino]propanoate.
| Compound Name | lithium 3-oxo-3-[3-(trifluoromethyl)anilino]propanoate |
|---|---|
| PubChem CID | 23693664 |
| Molecular Formula | C10H7F3LiNO3 |
| Molecular Weight | 253.10 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | lithium 3-oxo-3-[3-(trifluoromethyl)anilino]propanoate |
| SMILES | O=C([O-])CC(=O)Nc1cccc(C(F)(F)F)c1.[Li+] |
| InChI | InChI=1S/C10H8F3NO3.Li/c11-10(12,13)6-2-1-3-7(4-6)14-8(15)5-9(16)17;/h1-4H,5H2,(H,14,15)(H,16,17);/q;+1/p-1 |
| InChIKey | PDTCLFXMCMBCTD-UHFFFAOYSA-M |
| XLogP | -2.21 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.10 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|