C12H14F3NO4 — CID 65173322
2,2,2-trifluoroethyl N-[3-(2-methoxyethoxy)phenyl]carbamate (PubChem CID 65173322) has the molecular formula C12H14F3NO4 and a molecular weight of 293.24 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-[3-(2-methoxyethoxy)phenyl]carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-[3-(2-methoxyethoxy)phenyl]carbamate |
|---|---|
| PubChem CID | 65173322 |
| Molecular Formula | C12H14F3NO4 |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 2,2,2-trifluoroethyl N-[3-(2-methoxyethoxy)phenyl]carbamate |
| SMILES | COCCOc1cccc(NC(=O)OCC(F)(F)F)c1 |
| InChI | InChI=1S/C12H14F3NO4/c1-18-5-6-19-10-4-2-3-9(7-10)16-11(17)20-8-12(13,14)15/h2-4,7H,5-6,8H2,1H3,(H,16,17) |
| InChIKey | LUVWOYOEWWTHID-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|