C11H13F3N2O2 — CID 119291435
(2S)-2-amino-N-[3-(2,2,2-trifluoroethoxy)phenyl]propanamide (PubChem CID 119291435) has the molecular formula C11H13F3N2O2 and a molecular weight of 262.23 g/mol. Its IUPAC name is (2S)-2-amino-N-[3-(2,2,2-trifluoroethoxy)phenyl]propanamide.
| Compound Name | (2S)-2-amino-N-[3-(2,2,2-trifluoroethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 119291435 |
| Molecular Formula | C11H13F3N2O2 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | (2S)-2-amino-N-[3-(2,2,2-trifluoroethoxy)phenyl]propanamide |
| SMILES | C[C@H](N)C(=O)Nc1cccc(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C11H13F3N2O2/c1-7(15)10(17)16-8-3-2-4-9(5-8)18-6-11(12,13)14/h2-5,7H,6,15H2,1H3,(H,16,17)/t7-/m0/s1 |
| InChIKey | SISXFIHMUXQBSD-ZETCQYMHSA-N |
| XLogP | 1.91 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |