C13H13F3N2O3 — CID 65173271
2,2,2-trifluoroethyl N-[3-(3-cyanopropoxy)phenyl]carbamate (PubChem CID 65173271) has the molecular formula C13H13F3N2O3 and a molecular weight of 302.25 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-[3-(3-cyanopropoxy)phenyl]carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-[3-(3-cyanopropoxy)phenyl]carbamate |
|---|---|
| PubChem CID | 65173271 |
| Molecular Formula | C13H13F3N2O3 |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 2,2,2-trifluoroethyl N-[3-(3-cyanopropoxy)phenyl]carbamate |
| SMILES | N#CCCCOc1cccc(NC(=O)OCC(F)(F)F)c1 |
| InChI | InChI=1S/C13H13F3N2O3/c14-13(15,16)9-21-12(19)18-10-4-3-5-11(8-10)20-7-2-1-6-17/h3-5,8H,1-2,7,9H2,(H,18,19) |
| InChIKey | CEAXCHPJSGBRQA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|