C21H16F4N4O2 — CID 112846112
N-[3-(3-cyanopropoxy)phenyl]-1-(2-fluorophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 112846112) has the molecular formula C21H16F4N4O2 and a molecular weight of 432.38 g/mol. Its IUPAC name is N-[3-(3-cyanopropoxy)phenyl]-1-(2-fluorophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-[3-(3-cyanopropoxy)phenyl]-1-(2-fluorophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 112846112 |
| Molecular Formula | C21H16F4N4O2 |
| Molecular Weight | 432.38 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | N-[3-(3-cyanopropoxy)phenyl]-1-(2-fluorophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | N#CCCCOc1cccc(NC(=O)c2cnn(-c3ccccc3F)c2C(F)(F)F)c1 |
| InChI | InChI=1S/C21H16F4N4O2/c22-17-8-1-2-9-18(17)29-19(21(23,24)25)16(13-27-29)20(30)28-14-6-5-7-15(12-14)31-11-4-3-10-26/h1-2,5-9,12-13H,3-4,11H2,(H,28,30) |
| InChIKey | SDDYPXKMJSSSAU-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.38 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|