C19H16F4N4O3 — CID 112820470
1-(2-fluorophenyl)-N-[6-(2-methoxyethoxy)-3-pyridinyl]-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 112820470) has the molecular formula C19H16F4N4O3 and a molecular weight of 424.35 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-N-[6-(2-methoxyethoxy)-3-pyridinyl]-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | 1-(2-fluorophenyl)-N-[6-(2-methoxyethoxy)-3-pyridinyl]-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 112820470 |
| Molecular Formula | C19H16F4N4O3 |
| Molecular Weight | 424.35 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 1-(2-fluorophenyl)-N-[6-(2-methoxyethoxy)-3-pyridinyl]-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | COCCOc1ccc(NC(=O)c2cnn(-c3ccccc3F)c2C(F)(F)F)cn1 |
| InChI | InChI=1S/C19H16F4N4O3/c1-29-8-9-30-16-7-6-12(10-24-16)26-18(28)13-11-25-27(17(13)19(21,22)23)15-5-3-2-4-14(15)20/h2-7,10-11H,8-9H2,1H3,(H,26,28) |
| InChIKey | WVXLEEOTFUFJLG-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.35 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|