C17H9ClF5N3O — CID 39982766
N-(4-chloro-2-fluorophenyl)-1-(2-fluorophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 39982766) has the molecular formula C17H9ClF5N3O and a molecular weight of 401.72 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-1-(2-fluorophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-(4-chloro-2-fluorophenyl)-1-(2-fluorophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 39982766 |
| Molecular Formula | C17H9ClF5N3O |
| Molecular Weight | 401.72 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-1-(2-fluorophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1F)c1cnn(-c2ccccc2F)c1C(F)(F)F |
| InChI | InChI=1S/C17H9ClF5N3O/c18-9-5-6-13(12(20)7-9)25-16(27)10-8-24-26(15(10)17(21,22)23)14-4-2-1-3-11(14)19/h1-8H,(H,25,27) |
| InChIKey | QZHXBUFABMVKCB-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.72 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |