C11H8ClF3N4O — CID 82527528
1-(2-chlorophenyl)-5-(trifluoromethyl)pyrazole-4-carbohydrazide (PubChem CID 82527528) has the molecular formula C11H8ClF3N4O and a molecular weight of 304.66 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-5-(trifluoromethyl)pyrazole-4-carbohydrazide.
| Compound Name | 1-(2-chlorophenyl)-5-(trifluoromethyl)pyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 82527528 |
| Molecular Formula | C11H8ClF3N4O |
| Molecular Weight | 304.66 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 1-(2-chlorophenyl)-5-(trifluoromethyl)pyrazole-4-carbohydrazide |
| SMILES | NNC(=O)c1cnn(-c2ccccc2Cl)c1C(F)(F)F |
| InChI | InChI=1S/C11H8ClF3N4O/c12-7-3-1-2-4-8(7)19-9(11(13,14)15)6(5-17-19)10(20)18-16/h1-5H,16H2,(H,18,20) |
| InChIKey | GTLUCWAMNUKASZ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.66 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|