C18H22F4N4O2 — CID 112822501
1-(2-fluorophenyl)-N-[3-[2-methoxyethyl(methyl)amino]propyl]-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 112822501) has the molecular formula C18H22F4N4O2 and a molecular weight of 402.39 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-N-[3-[2-methoxyethyl(methyl)amino]propyl]-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | 1-(2-fluorophenyl)-N-[3-[2-methoxyethyl(methyl)amino]propyl]-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 112822501 |
| Molecular Formula | C18H22F4N4O2 |
| Molecular Weight | 402.39 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 1-(2-fluorophenyl)-N-[3-[2-methoxyethyl(methyl)amino]propyl]-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | COCCN(C)CCCNC(=O)c1cnn(-c2ccccc2F)c1C(F)(F)F |
| InChI | InChI=1S/C18H22F4N4O2/c1-25(10-11-28-2)9-5-8-23-17(27)13-12-24-26(16(13)18(20,21)22)15-7-4-3-6-14(15)19/h3-4,6-7,12H,5,8-11H2,1-2H3,(H,23,27) |
| InChIKey | IXOOLTMZXNLNOV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|