C22H28F4N4O — CID 112827081
N-[4-(3,5-dimethylpiperidin-1-yl)butyl]-1-(2-fluorophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 112827081) has the molecular formula C22H28F4N4O and a molecular weight of 440.49 g/mol. Its IUPAC name is N-[4-(3,5-dimethylpiperidin-1-yl)butyl]-1-(2-fluorophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-[4-(3,5-dimethylpiperidin-1-yl)butyl]-1-(2-fluorophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 112827081 |
| Molecular Formula | C22H28F4N4O |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | N-[4-(3,5-dimethylpiperidin-1-yl)butyl]-1-(2-fluorophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | CC1CC(C)CN(CCCCNC(=O)c2cnn(-c3ccccc3F)c2C(F)(F)F)C1 |
| InChI | InChI=1S/C22H28F4N4O/c1-15-11-16(2)14-29(13-15)10-6-5-9-27-21(31)17-12-28-30(20(17)22(24,25)26)19-8-4-3-7-18(19)23/h3-4,7-8,12,15-16H,5-6,9-11,13-14H2,1-2H3,(H,27,31) |
| InChIKey | NHMXEMSTUSZWLB-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|