C19H17F4N5O3 — CID 39489825
N-[3-(2-fluorophenoxy)propyl]-1-(6-methoxypyridazin-3-yl)-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 39489825) has the molecular formula C19H17F4N5O3 and a molecular weight of 439.37 g/mol. Its IUPAC name is N-[3-(2-fluorophenoxy)propyl]-1-(6-methoxypyridazin-3-yl)-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-[3-(2-fluorophenoxy)propyl]-1-(6-methoxypyridazin-3-yl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 39489825 |
| Molecular Formula | C19H17F4N5O3 |
| Molecular Weight | 439.37 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | N-[3-(2-fluorophenoxy)propyl]-1-(6-methoxypyridazin-3-yl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | COc1ccc(-n2ncc(C(=O)NCCCOc3ccccc3F)c2C(F)(F)F)nn1 |
| InChI | InChI=1S/C19H17F4N5O3/c1-30-16-8-7-15(26-27-16)28-17(19(21,22)23)12(11-25-28)18(29)24-9-4-10-31-14-6-3-2-5-13(14)20/h2-3,5-8,11H,4,9-10H2,1H3,(H,24,29) |
| InChIKey | GDEBDBNATXSJKB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|