C16H11F4N5O2 — CID 46530877
N-(2-fluorophenyl)-1-(6-methoxypyridazin-3-yl)-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 46530877) has the molecular formula C16H11F4N5O2 and a molecular weight of 381.29 g/mol. Its IUPAC name is N-(2-fluorophenyl)-1-(6-methoxypyridazin-3-yl)-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-(2-fluorophenyl)-1-(6-methoxypyridazin-3-yl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 46530877 |
| Molecular Formula | C16H11F4N5O2 |
| Molecular Weight | 381.29 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | N-(2-fluorophenyl)-1-(6-methoxypyridazin-3-yl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | COc1ccc(-n2ncc(C(=O)Nc3ccccc3F)c2C(F)(F)F)nn1 |
| InChI | InChI=1S/C16H11F4N5O2/c1-27-13-7-6-12(23-24-13)25-14(16(18,19)20)9(8-21-25)15(26)22-11-5-3-2-4-10(11)17/h2-8H,1H3,(H,22,26) |
| InChIKey | HJIUZRNDPFBULF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |