C22H23F3N6O2 — CID 55545330
N-[4-(azepan-1-yl)phenyl]-1-(6-methoxypyridazin-3-yl)-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 55545330) has the molecular formula C22H23F3N6O2 and a molecular weight of 460.46 g/mol. Its IUPAC name is N-[4-(azepan-1-yl)phenyl]-1-(6-methoxypyridazin-3-yl)-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-[4-(azepan-1-yl)phenyl]-1-(6-methoxypyridazin-3-yl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55545330 |
| Molecular Formula | C22H23F3N6O2 |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | N-[4-(azepan-1-yl)phenyl]-1-(6-methoxypyridazin-3-yl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | COc1ccc(-n2ncc(C(=O)Nc3ccc(N4CCCCCC4)cc3)c2C(F)(F)F)nn1 |
| InChI | InChI=1S/C22H23F3N6O2/c1-33-19-11-10-18(28-29-19)31-20(22(23,24)25)17(14-26-31)21(32)27-15-6-8-16(9-7-15)30-12-4-2-3-5-13-30/h6-11,14H,2-5,12-13H2,1H3,(H,27,32) |
| InChIKey | NVAOWCCYQIQRLB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|