C23H24F3N5O — CID 55510180
N-[4-(azepan-1-yl)phenyl]-5-methyl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazole-4-carboxamide (PubChem CID 55510180) has the molecular formula C23H24F3N5O and a molecular weight of 443.47 g/mol. Its IUPAC name is N-[4-(azepan-1-yl)phenyl]-5-methyl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazole-4-carboxamide.
| Compound Name | N-[4-(azepan-1-yl)phenyl]-5-methyl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55510180 |
| Molecular Formula | C23H24F3N5O |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | N-[4-(azepan-1-yl)phenyl]-5-methyl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc(N3CCCCCC3)cc2)cnn1-c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C23H24F3N5O/c1-16-20(15-28-31(16)21-11-6-17(14-27-21)23(24,25)26)22(32)29-18-7-9-19(10-8-18)30-12-4-2-3-5-13-30/h6-11,14-15H,2-5,12-13H2,1H3,(H,29,32) |
| InChIKey | XQWCQLUNIGYZRX-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|