C24H25F3N4O — CID 55465714
N-[4-(azepan-1-yl)phenyl]-1-(4-methylphenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 55465714) has the molecular formula C24H25F3N4O and a molecular weight of 442.49 g/mol. Its IUPAC name is N-[4-(azepan-1-yl)phenyl]-1-(4-methylphenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-[4-(azepan-1-yl)phenyl]-1-(4-methylphenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55465714 |
| Molecular Formula | C24H25F3N4O |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | N-[4-(azepan-1-yl)phenyl]-1-(4-methylphenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | Cc1ccc(-n2ncc(C(=O)Nc3ccc(N4CCCCCC4)cc3)c2C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H25F3N4O/c1-17-6-10-20(11-7-17)31-22(24(25,26)27)21(16-28-31)23(32)29-18-8-12-19(13-9-18)30-14-4-2-3-5-15-30/h6-13,16H,2-5,14-15H2,1H3,(H,29,32) |
| InChIKey | JUKVYKIEUZYKMZ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|