C23H23F3N4O — CID 18229003
N-[4-(4-methylpiperidin-1-yl)phenyl]-1-phenyl-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 18229003) has the molecular formula C23H23F3N4O and a molecular weight of 428.46 g/mol. Its IUPAC name is N-[4-(4-methylpiperidin-1-yl)phenyl]-1-phenyl-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-[4-(4-methylpiperidin-1-yl)phenyl]-1-phenyl-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 18229003 |
| Molecular Formula | C23H23F3N4O |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | N-[4-(4-methylpiperidin-1-yl)phenyl]-1-phenyl-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | CC1CCN(c2ccc(NC(=O)c3cnn(-c4ccccc4)c3C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C23H23F3N4O/c1-16-11-13-29(14-12-16)18-9-7-17(8-10-18)28-22(31)20-15-27-30(21(20)23(24,25)26)19-5-3-2-4-6-19/h2-10,15-16H,11-14H2,1H3,(H,28,31) |
| InChIKey | DAYPQRBHKZDGOU-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|