C24H27FN4O — CID 56556091
1-(4-fluorophenyl)-N-[4-(3-methylpyrrolidin-1-yl)phenyl]-5-propan-2-ylpyrazole-4-carboxamide (PubChem CID 56556091) has the molecular formula C24H27FN4O and a molecular weight of 406.51 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[4-(3-methylpyrrolidin-1-yl)phenyl]-5-propan-2-ylpyrazole-4-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N-[4-(3-methylpyrrolidin-1-yl)phenyl]-5-propan-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 56556091 |
| Molecular Formula | C24H27FN4O |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[4-(3-methylpyrrolidin-1-yl)phenyl]-5-propan-2-ylpyrazole-4-carboxamide |
| SMILES | CC1CCN(c2ccc(NC(=O)c3cnn(-c4ccc(F)cc4)c3C(C)C)cc2)C1 |
| InChI | InChI=1S/C24H27FN4O/c1-16(2)23-22(14-26-29(23)21-8-4-18(25)5-9-21)24(30)27-19-6-10-20(11-7-19)28-13-12-17(3)15-28/h4-11,14,16-17H,12-13,15H2,1-3H3,(H,27,30) |
| InChIKey | VXLNABJUXBUYKL-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|