C22H21FN2O2 — CID 56556263
5-(4-fluorophenyl)-N-[4-(3-methylpyrrolidin-1-yl)phenyl]furan-2-carboxamide (PubChem CID 56556263) has the molecular formula C22H21FN2O2 and a molecular weight of 364.42 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-[4-(3-methylpyrrolidin-1-yl)phenyl]furan-2-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-N-[4-(3-methylpyrrolidin-1-yl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 56556263 |
| Molecular Formula | C22H21FN2O2 |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 5-(4-fluorophenyl)-N-[4-(3-methylpyrrolidin-1-yl)phenyl]furan-2-carboxamide |
| SMILES | CC1CCN(c2ccc(NC(=O)c3ccc(-c4ccc(F)cc4)o3)cc2)C1 |
| InChI | InChI=1S/C22H21FN2O2/c1-15-12-13-25(14-15)19-8-6-18(7-9-19)24-22(26)21-11-10-20(27-21)16-2-4-17(23)5-3-16/h2-11,15H,12-14H2,1H3,(H,24,26) |
| InChIKey | CHSNPNNVMWIGIP-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|