C17H19ClN3O4- — CID 53352982
N-[4-(4-methylpiperidin-1-yl)phenyl]-5-nitrofuran-2-carboxamide chloride (PubChem CID 53352982) has the molecular formula C17H19ClN3O4- and a molecular weight of 364.81 g/mol. Its IUPAC name is N-[4-(4-methylpiperidin-1-yl)phenyl]-5-nitrofuran-2-carboxamide chloride.
| Compound Name | N-[4-(4-methylpiperidin-1-yl)phenyl]-5-nitrofuran-2-carboxamide chloride |
|---|---|
| PubChem CID | 53352982 |
| Molecular Formula | C17H19ClN3O4- |
| Molecular Weight | 364.81 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | N-[4-(4-methylpiperidin-1-yl)phenyl]-5-nitrofuran-2-carboxamide chloride |
| SMILES | CC1CCN(c2ccc(NC(=O)c3ccc([N+](=O)[O-])o3)cc2)CC1.[Cl-] |
| InChI | InChI=1S/C17H19N3O4.ClH/c1-12-8-10-19(11-9-12)14-4-2-13(3-5-14)18-17(21)15-6-7-16(24-15)20(22)23;/h2-7,12H,8-11H2,1H3,(H,18,21);1H/p-1 |
| InChIKey | RYQYCGTZCULATE-UHFFFAOYSA-M |
| XLogP | 0.68 |
| TPSA | 88.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.81 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|