C17H18FN3O5 — CID 94084965
N-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-5-nitrofuran-2-carboxamide (PubChem CID 94084965) has the molecular formula C17H18FN3O5 and a molecular weight of 363.35 g/mol. Its IUPAC name is N-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-5-nitrofuran-2-carboxamide.
| Compound Name | N-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 94084965 |
| Molecular Formula | C17H18FN3O5 |
| Molecular Weight | 363.35 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | N-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-5-nitrofuran-2-carboxamide |
| SMILES | C[C@@H]1CN(c2ccc(NC(=O)c3ccc([N+](=O)[O-])o3)cc2F)C[C@@H](C)O1 |
| InChI | InChI=1S/C17H18FN3O5/c1-10-8-20(9-11(2)25-10)14-4-3-12(7-13(14)18)19-17(22)15-5-6-16(26-15)21(23)24/h3-7,10-11H,8-9H2,1-2H3,(H,19,22)/t10-,11-/m1/s1 |
| InChIKey | AXCIWAVCVTXATQ-GHMZBOCLSA-N |
| XLogP | 3.19 |
| TPSA | 97.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|