C22H26FN3O7 — CID 55799936
N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-3,4,5-trimethoxy-2-nitrobenzamide (PubChem CID 55799936) has the molecular formula C22H26FN3O7 and a molecular weight of 463.46 g/mol. Its IUPAC name is N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-3,4,5-trimethoxy-2-nitrobenzamide.
| Compound Name | N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-3,4,5-trimethoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 55799936 |
| Molecular Formula | C22H26FN3O7 |
| Molecular Weight | 463.46 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-3,4,5-trimethoxy-2-nitrobenzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(N3CC(C)OC(C)C3)c(F)c2)c([N+](=O)[O-])c(OC)c1OC |
| InChI | InChI=1S/C22H26FN3O7/c1-12-10-25(11-13(2)33-12)17-7-6-14(8-16(17)23)24-22(27)15-9-18(30-3)20(31-4)21(32-5)19(15)26(28)29/h6-9,12-13H,10-11H2,1-5H3,(H,24,27) |
| InChIKey | KHOGJLWFDVQAER-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 112.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.46 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|