C16H22FN3O2 — CID 47042942
1-cyclopropyl-3-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]urea (PubChem CID 47042942) has the molecular formula C16H22FN3O2 and a molecular weight of 307.37 g/mol. Its IUPAC name is 1-cyclopropyl-3-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]urea.
| Compound Name | 1-cyclopropyl-3-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]urea |
|---|---|
| PubChem CID | 47042942 |
| Molecular Formula | C16H22FN3O2 |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 1-cyclopropyl-3-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]urea |
| SMILES | CC1CN(c2ccc(NC(=O)NC3CC3)cc2F)CC(C)O1 |
| InChI | InChI=1S/C16H22FN3O2/c1-10-8-20(9-11(2)22-10)15-6-5-13(7-14(15)17)19-16(21)18-12-3-4-12/h5-7,10-12H,3-4,8-9H2,1-2H3,(H2,18,19,21) |
| InChIKey | UAHSWNCKSZDVMV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|