C22H27FN4O3 — CID 55747141
N-[3-[[[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]carbamoylamino]methyl]phenyl]acetamide (PubChem CID 55747141) has the molecular formula C22H27FN4O3 and a molecular weight of 414.48 g/mol. Its IUPAC name is N-[3-[[[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]carbamoylamino]methyl]phenyl]acetamide.
| Compound Name | N-[3-[[[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]carbamoylamino]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 55747141 |
| Molecular Formula | C22H27FN4O3 |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | N-[3-[[[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]carbamoylamino]methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(CNC(=O)Nc2ccc(N3CC(C)OC(C)C3)c(F)c2)c1 |
| InChI | InChI=1S/C22H27FN4O3/c1-14-12-27(13-15(2)30-14)21-8-7-19(10-20(21)23)26-22(29)24-11-17-5-4-6-18(9-17)25-16(3)28/h4-10,14-15H,11-13H2,1-3H3,(H,25,28)(H2,24,26,29) |
| InChIKey | XXMNIIIRICKOKT-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|