C15H20ClFN2O2 — CID 96582200
2-chloro-N-[[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]methyl]acetamide (PubChem CID 96582200) has the molecular formula C15H20ClFN2O2 and a molecular weight of 314.79 g/mol. Its IUPAC name is 2-chloro-N-[[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]methyl]acetamide.
| Compound Name | 2-chloro-N-[[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]methyl]acetamide |
|---|---|
| PubChem CID | 96582200 |
| Molecular Formula | C15H20ClFN2O2 |
| Molecular Weight | 314.79 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 2-chloro-N-[[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]methyl]acetamide |
| SMILES | C[C@H]1CN(c2ccc(CNC(=O)CCl)cc2F)C[C@H](C)O1 |
| InChI | InChI=1S/C15H20ClFN2O2/c1-10-8-19(9-11(2)21-10)14-4-3-12(5-13(14)17)7-18-15(20)6-16/h3-5,10-11H,6-9H2,1-2H3,(H,18,20)/t10-,11-/m0/s1 |
| InChIKey | JLJZYFJUQMMLCQ-QWRGUYRKSA-N |
| XLogP | 2.29 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.79 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|