C21H24FN3O2S — CID 94840333
4-carbamothioyl-N-[[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]methyl]benzamide (PubChem CID 94840333) has the molecular formula C21H24FN3O2S and a molecular weight of 401.51 g/mol. Its IUPAC name is 4-carbamothioyl-N-[[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]methyl]benzamide.
| Compound Name | 4-carbamothioyl-N-[[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]methyl]benzamide |
|---|---|
| PubChem CID | 94840333 |
| Molecular Formula | C21H24FN3O2S |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 4-carbamothioyl-N-[[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]methyl]benzamide |
| SMILES | C[C@H]1CN(c2ccc(CNC(=O)c3ccc(C(N)=S)cc3)cc2F)C[C@H](C)O1 |
| InChI | InChI=1S/C21H24FN3O2S/c1-13-11-25(12-14(2)27-13)19-8-3-15(9-18(19)22)10-24-21(26)17-6-4-16(5-7-17)20(23)28/h3-9,13-14H,10-12H2,1-2H3,(H2,23,28)(H,24,26)/t13-,14-/m0/s1 |
| InChIKey | FQCLTEYFLKULCT-KBPBESRZSA-N |
| XLogP | 3.00 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|