C22H25FN4O4 — CID 95329562
1-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-3-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]urea (PubChem CID 95329562) has the molecular formula C22H25FN4O4 and a molecular weight of 428.46 g/mol. Its IUPAC name is 1-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-3-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]urea.
| Compound Name | 1-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-3-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]urea |
|---|---|
| PubChem CID | 95329562 |
| Molecular Formula | C22H25FN4O4 |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 1-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-3-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]urea |
| SMILES | C[C@@H]1CN(c2ccc(NC(=O)Nc3cccc(N4CCOC4=O)c3)cc2F)C[C@H](C)O1 |
| InChI | InChI=1S/C22H25FN4O4/c1-14-12-26(13-15(2)31-14)20-7-6-17(11-19(20)23)25-21(28)24-16-4-3-5-18(10-16)27-8-9-30-22(27)29/h3-7,10-11,14-15H,8-9,12-13H2,1-2H3,(H2,24,25,28)/t14-,15+ |
| InChIKey | NAHVRWDVIPNUSS-GASCZTMLSA-N |
| XLogP | 4.04 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|