C20H29FN4O3 — CID 47050945
1-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-3-[1-(2-oxopyrrolidin-1-yl)propan-2-yl]urea (PubChem CID 47050945) has the molecular formula C20H29FN4O3 and a molecular weight of 392.48 g/mol. Its IUPAC name is 1-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-3-[1-(2-oxopyrrolidin-1-yl)propan-2-yl]urea.
| Compound Name | 1-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-3-[1-(2-oxopyrrolidin-1-yl)propan-2-yl]urea |
|---|---|
| PubChem CID | 47050945 |
| Molecular Formula | C20H29FN4O3 |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 1-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-3-[1-(2-oxopyrrolidin-1-yl)propan-2-yl]urea |
| SMILES | CC(CN1CCCC1=O)NC(=O)Nc1ccc(N2CC(C)OC(C)C2)c(F)c1 |
| InChI | InChI=1S/C20H29FN4O3/c1-13(10-24-8-4-5-19(24)26)22-20(27)23-16-6-7-18(17(21)9-16)25-11-14(2)28-15(3)12-25/h6-7,9,13-15H,4-5,8,10-12H2,1-3H3,(H2,22,23,27) |
| InChIKey | RNXNCWBMRGWJGT-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|