C17H21FN4O3 — CID 94647091
1-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-3-(5-methyl-1,2-oxazol-3-yl)urea (PubChem CID 94647091) has the molecular formula C17H21FN4O3 and a molecular weight of 348.38 g/mol. Its IUPAC name is 1-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-3-(5-methyl-1,2-oxazol-3-yl)urea.
| Compound Name | 1-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-3-(5-methyl-1,2-oxazol-3-yl)urea |
|---|---|
| PubChem CID | 94647091 |
| Molecular Formula | C17H21FN4O3 |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 1-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-3-(5-methyl-1,2-oxazol-3-yl)urea |
| SMILES | Cc1cc(NC(=O)Nc2ccc(N3C[C@@H](C)O[C@H](C)C3)c(F)c2)no1 |
| InChI | InChI=1S/C17H21FN4O3/c1-10-6-16(21-25-10)20-17(23)19-13-4-5-15(14(18)7-13)22-8-11(2)24-12(3)9-22/h4-7,11-12H,8-9H2,1-3H3,(H2,19,20,21,23)/t11-,12-/m1/s1 |
| InChIKey | LMRVEIGIFPJSQL-VXGBXAGGSA-N |
| XLogP | 3.38 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|