C16H24FN3O3 — CID 94189672
1-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-3-(2-methoxyethyl)urea (PubChem CID 94189672) has the molecular formula C16H24FN3O3 and a molecular weight of 325.38 g/mol. Its IUPAC name is 1-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-3-(2-methoxyethyl)urea.
| Compound Name | 1-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-3-(2-methoxyethyl)urea |
|---|---|
| PubChem CID | 94189672 |
| Molecular Formula | C16H24FN3O3 |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 1-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-3-(2-methoxyethyl)urea |
| SMILES | COCCNC(=O)Nc1ccc(N2C[C@@H](C)O[C@@H](C)C2)c(F)c1 |
| InChI | InChI=1S/C16H24FN3O3/c1-11-9-20(10-12(2)23-11)15-5-4-13(8-14(15)17)19-16(21)18-6-7-22-3/h4-5,8,11-12H,6-7,9-10H2,1-3H3,(H2,18,19,21)/t11-,12+ |
| InChIKey | XZBJBRVGWXPBHI-TXEJJXNPSA-N |
| XLogP | 2.21 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|