C21H25ClFN3O4S — CID 52507747
1-[2-(4-chlorophenyl)sulfonylethyl]-3-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]urea (PubChem CID 52507747) has the molecular formula C21H25ClFN3O4S and a molecular weight of 469.97 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)sulfonylethyl]-3-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]urea.
| Compound Name | 1-[2-(4-chlorophenyl)sulfonylethyl]-3-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]urea |
|---|---|
| PubChem CID | 52507747 |
| Molecular Formula | C21H25ClFN3O4S |
| Molecular Weight | 469.97 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | 1-[2-(4-chlorophenyl)sulfonylethyl]-3-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]urea |
| SMILES | C[C@H]1CN(c2ccc(NC(=O)NCCS(=O)(=O)c3ccc(Cl)cc3)cc2F)C[C@H](C)O1 |
| InChI | InChI=1S/C21H25ClFN3O4S/c1-14-12-26(13-15(2)30-14)20-8-5-17(11-19(20)23)25-21(27)24-9-10-31(28,29)18-6-3-16(22)4-7-18/h3-8,11,14-15H,9-10,12-13H2,1-2H3,(H2,24,25,27)/t14-,15-/m0/s1 |
| InChIKey | MDIWCNOKFIBPDO-GJZGRUSLSA-N |
| XLogP | 3.69 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.97 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|