C20H32FN3O3 — CID 97256038
1-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-3-(5-hydroxy-2,2-dimethylpentyl)urea (PubChem CID 97256038) has the molecular formula C20H32FN3O3 and a molecular weight of 381.49 g/mol. Its IUPAC name is 1-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-3-(5-hydroxy-2,2-dimethylpentyl)urea.
| Compound Name | 1-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-3-(5-hydroxy-2,2-dimethylpentyl)urea |
|---|---|
| PubChem CID | 97256038 |
| Molecular Formula | C20H32FN3O3 |
| Molecular Weight | 381.49 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | 1-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-3-(5-hydroxy-2,2-dimethylpentyl)urea |
| SMILES | C[C@@H]1CN(c2ccc(NC(=O)NCC(C)(C)CCCO)cc2F)C[C@@H](C)O1 |
| InChI | InChI=1S/C20H32FN3O3/c1-14-11-24(12-15(2)27-14)18-7-6-16(10-17(18)21)23-19(26)22-13-20(3,4)8-5-9-25/h6-7,10,14-15,25H,5,8-9,11-13H2,1-4H3,(H2,22,23,26)/t14-,15-/m1/s1 |
| InChIKey | YMMBJMMMNYFGLI-HUUCEWRRSA-N |
| XLogP | 3.36 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.49 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|