C23H28FN3O4 — CID 52531359
1-[2-(1,3-benzodioxol-5-yl)propan-2-yl]-3-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]urea (PubChem CID 52531359) has the molecular formula C23H28FN3O4 and a molecular weight of 429.49 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)propan-2-yl]-3-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]urea.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)propan-2-yl]-3-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]urea |
|---|---|
| PubChem CID | 52531359 |
| Molecular Formula | C23H28FN3O4 |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)propan-2-yl]-3-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]urea |
| SMILES | C[C@@H]1CN(c2ccc(NC(=O)NC(C)(C)c3ccc4c(c3)OCO4)cc2F)C[C@@H](C)O1 |
| InChI | InChI=1S/C23H28FN3O4/c1-14-11-27(12-15(2)31-14)19-7-6-17(10-18(19)24)25-22(28)26-23(3,4)16-5-8-20-21(9-16)30-13-29-20/h5-10,14-15H,11-13H2,1-4H3,(H2,25,26,28)/t14-,15-/m1/s1 |
| InChIKey | LTWPLCYYGKTYRM-HUUCEWRRSA-N |
| XLogP | 4.22 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|