C21H29FN4O2S — CID 100853661
1-[(2R)-2-(dimethylamino)-2-thiophen-2-ylethyl]-3-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]urea (PubChem CID 100853661) has the molecular formula C21H29FN4O2S and a molecular weight of 420.55 g/mol. Its IUPAC name is 1-[(2R)-2-(dimethylamino)-2-thiophen-2-ylethyl]-3-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]urea.
| Compound Name | 1-[(2R)-2-(dimethylamino)-2-thiophen-2-ylethyl]-3-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]urea |
|---|---|
| PubChem CID | 100853661 |
| Molecular Formula | C21H29FN4O2S |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 1-[(2R)-2-(dimethylamino)-2-thiophen-2-ylethyl]-3-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]urea |
| SMILES | C[C@@H]1CN(c2ccc(NC(=O)NC[C@H](c3cccs3)N(C)C)cc2F)C[C@@H](C)O1 |
| InChI | InChI=1S/C21H29FN4O2S/c1-14-12-26(13-15(2)28-14)18-8-7-16(10-17(18)22)24-21(27)23-11-19(25(3)4)20-6-5-9-29-20/h5-10,14-15,19H,11-13H2,1-4H3,(H2,23,24,27)/t14-,15-,19-/m1/s1 |
| InChIKey | PRPMLKFYHNBGTJ-SPYBWZPUSA-N |
| XLogP | 3.93 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|