C22H26FN5O2 — CID 51122260
1-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-3-[(7-methylimidazo[1,2-a]pyridin-2-yl)methyl]urea (PubChem CID 51122260) has the molecular formula C22H26FN5O2 and a molecular weight of 411.48 g/mol. Its IUPAC name is 1-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-3-[(7-methylimidazo[1,2-a]pyridin-2-yl)methyl]urea.
| Compound Name | 1-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-3-[(7-methylimidazo[1,2-a]pyridin-2-yl)methyl]urea |
|---|---|
| PubChem CID | 51122260 |
| Molecular Formula | C22H26FN5O2 |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 1-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-3-[(7-methylimidazo[1,2-a]pyridin-2-yl)methyl]urea |
| SMILES | Cc1ccn2cc(CNC(=O)Nc3ccc(N4CC(C)OC(C)C4)c(F)c3)nc2c1 |
| InChI | InChI=1S/C22H26FN5O2/c1-14-6-7-27-13-18(25-21(27)8-14)10-24-22(29)26-17-4-5-20(19(23)9-17)28-11-15(2)30-16(3)12-28/h4-9,13,15-16H,10-12H2,1-3H3,(H2,24,26,29) |
| InChIKey | YOTXEPKVAQPUAO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 70.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|