C21H23FN4O2 — CID 55799893
N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-7-methylimidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 55799893) has the molecular formula C21H23FN4O2 and a molecular weight of 382.44 g/mol. Its IUPAC name is N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-7-methylimidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-7-methylimidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 55799893 |
| Molecular Formula | C21H23FN4O2 |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-7-methylimidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | Cc1ccn2cc(C(=O)Nc3ccc(N4CC(C)OC(C)C4)c(F)c3)nc2c1 |
| InChI | InChI=1S/C21H23FN4O2/c1-13-6-7-25-12-18(24-20(25)8-13)21(27)23-16-4-5-19(17(22)9-16)26-10-14(2)28-15(3)11-26/h4-9,12,14-15H,10-11H2,1-3H3,(H,23,27) |
| InChIKey | WBKWBLWVUVMSIA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|