C23H24F2N4O2 — CID 95383368
N-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-7-fluoro-2,3-dimethylquinoxaline-5-carboxamide (PubChem CID 95383368) has the molecular formula C23H24F2N4O2 and a molecular weight of 426.47 g/mol. Its IUPAC name is N-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-7-fluoro-2,3-dimethylquinoxaline-5-carboxamide.
| Compound Name | N-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-7-fluoro-2,3-dimethylquinoxaline-5-carboxamide |
|---|---|
| PubChem CID | 95383368 |
| Molecular Formula | C23H24F2N4O2 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | N-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-7-fluoro-2,3-dimethylquinoxaline-5-carboxamide |
| SMILES | Cc1nc2cc(F)cc(C(=O)Nc3ccc(N4C[C@@H](C)O[C@@H](C)C4)c(F)c3)c2nc1C |
| InChI | InChI=1S/C23H24F2N4O2/c1-12-10-29(11-13(2)31-12)21-6-5-17(9-19(21)25)28-23(30)18-7-16(24)8-20-22(18)27-15(4)14(3)26-20/h5-9,12-13H,10-11H2,1-4H3,(H,28,30)/t12-,13+ |
| InChIKey | HESWIFKIEYEIOD-BETUJISGSA-N |
| XLogP | 4.39 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|