About N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-4-ethylthiadiazole-5-carboxamide
N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-4-ethylthiadiazole-5-carboxamide (PubChem CID 102556139) has the molecular formula C17H21FN4O2S
and a molecular weight of 364.45 g/mol. Its IUPAC name is N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-4-ethylthiadiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-4-ethylthiadiazole-5-carboxamide |
| PubChem CID | 102556139 |
| Molecular Formula | C17H21FN4O2S |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-4-ethylthiadiazole-5-carboxamide |
| SMILES | CCc1nnsc1C(=O)Nc1ccc(N2CC(C)OC(C)C2)c(F)c1 |
| InChI | InChI=1S/C17H21FN4O2S/c1-4-14-16(25-21-20-14)17(23)19-12-5-6-15(13(18)7-12)22-8-10(2)24-11(3)9-22/h5-7,10-11H,4,8-9H2,1-3H3,(H,19,23) |
| InChIKey | LMCKANNNFFMPLB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-4-ethylthiadiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-4-ethylthiadiazole-5-carboxamide?
The IUPAC name of N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-4-ethylthiadiazole-5-carboxamide (CID 102556139) is N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-4-ethylthiadiazole-5-carboxamide.
What is the SMILES notation for N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-4-ethylthiadiazole-5-carboxamide?
The canonical SMILES for N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-4-ethylthiadiazole-5-carboxamide is CCc1nnsc1C(=O)Nc1ccc(N2CC(C)OC(C)C2)c(F)c1.
What is the InChIKey of N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-4-ethylthiadiazole-5-carboxamide?
The InChIKey is LMCKANNNFFMPLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21FN4O2S/c1-4-14-16(25-21-20-14)17(23)19-12-5-6-15(13(18)7-12)22-8-10(2)24-11(3)9-22/h5-7,10-11H,4,8-9H2,1-3H3,(H,19,23).
What are the key properties of N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-4-ethylthiadiazole-5-carboxamide?
N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-4-ethylthiadiazole-5-carboxamide has a molecular weight of 364.45 g/mol, XLogP of 3.11, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-4-ethylthiadiazole-5-carboxamide is sourced from PubChem (CID 102556139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).