C17H20FN5O2 — CID 94184034
3-amino-N-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]pyrazine-2-carboxamide (PubChem CID 94184034) has the molecular formula C17H20FN5O2 and a molecular weight of 345.38 g/mol. Its IUPAC name is 3-amino-N-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]pyrazine-2-carboxamide.
| Compound Name | 3-amino-N-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 94184034 |
| Molecular Formula | C17H20FN5O2 |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 3-amino-N-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]pyrazine-2-carboxamide |
| SMILES | C[C@H]1CN(c2ccc(NC(=O)c3nccnc3N)cc2F)C[C@H](C)O1 |
| InChI | InChI=1S/C17H20FN5O2/c1-10-8-23(9-11(2)25-10)14-4-3-12(7-13(14)18)22-17(24)15-16(19)21-6-5-20-15/h3-7,10-11H,8-9H2,1-2H3,(H2,19,21)(H,22,24)/t10-,11-/m0/s1 |
| InChIKey | ZKYZETXYZNBYQJ-QWRGUYRKSA-N |
| XLogP | 2.06 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|