C18H23FN4O2S — CID 52538036
N-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-2-(1-methylimidazol-2-yl)sulfanylacetamide (PubChem CID 52538036) has the molecular formula C18H23FN4O2S and a molecular weight of 378.47 g/mol. Its IUPAC name is N-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-2-(1-methylimidazol-2-yl)sulfanylacetamide.
| Compound Name | N-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-2-(1-methylimidazol-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 52538036 |
| Molecular Formula | C18H23FN4O2S |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | N-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-2-(1-methylimidazol-2-yl)sulfanylacetamide |
| SMILES | C[C@H]1CN(c2ccc(NC(=O)CSc3nccn3C)cc2F)C[C@H](C)O1 |
| InChI | InChI=1S/C18H23FN4O2S/c1-12-9-23(10-13(2)25-12)16-5-4-14(8-15(16)19)21-17(24)11-26-18-20-6-7-22(18)3/h4-8,12-13H,9-11H2,1-3H3,(H,21,24)/t12-,13-/m0/s1 |
| InChIKey | AAJVGXFSLHRDJO-STQMWFEESA-N |
| XLogP | 2.90 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|