C19H25FN2O4S — CID 98765257
(3S)-3-[2-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-fluoroanilino]-2-oxoethyl]thiolane-3-carboxylic acid (PubChem CID 98765257) has the molecular formula C19H25FN2O4S and a molecular weight of 396.48 g/mol. Its IUPAC name is (3S)-3-[2-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-fluoroanilino]-2-oxoethyl]thiolane-3-carboxylic acid.
| Compound Name | (3S)-3-[2-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-fluoroanilino]-2-oxoethyl]thiolane-3-carboxylic acid |
|---|---|
| PubChem CID | 98765257 |
| Molecular Formula | C19H25FN2O4S |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | (3S)-3-[2-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-fluoroanilino]-2-oxoethyl]thiolane-3-carboxylic acid |
| SMILES | C[C@@H]1CN(c2ccc(NC(=O)C[C@@]3(C(=O)O)CCSC3)cc2F)C[C@H](C)O1 |
| InChI | InChI=1S/C19H25FN2O4S/c1-12-9-22(10-13(2)26-12)16-4-3-14(7-15(16)20)21-17(23)8-19(18(24)25)5-6-27-11-19/h3-4,7,12-13H,5-6,8-11H2,1-2H3,(H,21,23)(H,24,25)/t12-,13+,19-/m0/s1 |
| InChIKey | IODVYTRKSYWVOX-QUJCMNEKSA-N |
| XLogP | 2.98 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|