C22H29FN4O4 — CID 55800013
N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide (PubChem CID 55800013) has the molecular formula C22H29FN4O4 and a molecular weight of 432.50 g/mol. Its IUPAC name is N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide.
| Compound Name | N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
|---|---|
| PubChem CID | 55800013 |
| Molecular Formula | C22H29FN4O4 |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
| SMILES | CC1CN(c2ccc(NC(=O)CN3C(=O)NC4(CCCCC4)C3=O)cc2F)CC(C)O1 |
| InChI | InChI=1S/C22H29FN4O4/c1-14-11-26(12-15(2)31-14)18-7-6-16(10-17(18)23)24-19(28)13-27-20(29)22(25-21(27)30)8-4-3-5-9-22/h6-7,10,14-15H,3-5,8-9,11-13H2,1-2H3,(H,24,28)(H,25,30) |
| InChIKey | KFZJUPOYYFFKLA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|