C18H21F2N3O3 — CID 46665812
N-(3,5-difluorophenyl)-2-(2,4-dioxo-1,3-diazaspiro[4.7]dodecan-3-yl)acetamide (PubChem CID 46665812) has the molecular formula C18H21F2N3O3 and a molecular weight of 365.38 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-2-(2,4-dioxo-1,3-diazaspiro[4.7]dodecan-3-yl)acetamide.
| Compound Name | N-(3,5-difluorophenyl)-2-(2,4-dioxo-1,3-diazaspiro[4.7]dodecan-3-yl)acetamide |
|---|---|
| PubChem CID | 46665812 |
| Molecular Formula | C18H21F2N3O3 |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | N-(3,5-difluorophenyl)-2-(2,4-dioxo-1,3-diazaspiro[4.7]dodecan-3-yl)acetamide |
| SMILES | O=C(CN1C(=O)NC2(CCCCCCC2)C1=O)Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C18H21F2N3O3/c19-12-8-13(20)10-14(9-12)21-15(24)11-23-16(25)18(22-17(23)26)6-4-2-1-3-5-7-18/h8-10H,1-7,11H2,(H,21,24)(H,22,26) |
| InChIKey | NIDZYAINHSZCHP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|