C18H17F6N3O3 — CID 2459919
N-[3,5-bis(trifluoromethyl)phenyl]-2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide (PubChem CID 2459919) has the molecular formula C18H17F6N3O3 and a molecular weight of 437.34 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
|---|---|
| PubChem CID | 2459919 |
| Molecular Formula | C18H17F6N3O3 |
| Molecular Weight | 437.34 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
| SMILES | O=C(CN1C(=O)NC2(CCCCC2)C1=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H17F6N3O3/c19-17(20,21)10-6-11(18(22,23)24)8-12(7-10)25-13(28)9-27-14(29)16(26-15(27)30)4-2-1-3-5-16/h6-8H,1-5,9H2,(H,25,28)(H,26,30) |
| InChIKey | IOHYLDBTAUZOMB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.34 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|