C22H19F6N3O3 — CID 39950257
N-[3,5-bis(trifluoromethyl)phenyl]-2-[(4R)-4-ethyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 39950257) has the molecular formula C22H19F6N3O3 and a molecular weight of 487.40 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-2-[(4R)-4-ethyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-2-[(4R)-4-ethyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 39950257 |
| Molecular Formula | C22H19F6N3O3 |
| Molecular Weight | 487.40 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-2-[(4R)-4-ethyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CC[C@]1(c2ccc(C)cc2)NC(=O)N(CC(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C22H19F6N3O3/c1-3-20(13-6-4-12(2)5-7-13)18(33)31(19(34)30-20)11-17(32)29-16-9-14(21(23,24)25)8-15(10-16)22(26,27)28/h4-10H,3,11H2,1-2H3,(H,29,32)(H,30,34)/t20-/m1/s1 |
| InChIKey | HYMNGKHPISTZMA-HXUWFJFHSA-N |
| XLogP | 4.83 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.40 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|